Your Location：Home > Products > Glycine Anhydride
CAS No:106-57-0
MF:C4H6N2O2
Appearance:white or off-white crystalline powder
Specification:99.0%
Package:1/5/10/25kg/drum
Supply Capacity:Tons
Synonyms:Glycine Anhydride; Piperazine-2,5-Quinone; 5-24-05-00294 (Beilstein Handbook Reference); Brn 0112112; PIPERAZINE-2,5-DIONE;Glycine EP Impurity B;Oxiracetam-1;2,5-Dioxopiperazin;2,5-Dioxopiperazine lactam;2,5-Piperazindion;alpha,gamma-Diacipiperazine;Cyclic(glycylglycyl); Piperazine-2,5-dione; 2,5-Piperazinedione; 106-57-0; GLYCINE ANHYDRIDE; 2,5-DIKETOPIPERAZINE; 2,5-Dioxopiperazine; Cycloglycylglycine; Cyclodiglycine; Glycylglycine lactam; Cyclo(glycylglycyl); Diglycolyl diamide; Glycine, bimol. cyclic peptide; diglycolyldiamide; alpha,gamma-Diacipiperazine; CHEBI:16535; 240L69DTV7; NSC-26345; DTXSID8059342; 2,5-Diazacyclohexane-1,4-dione; cyclo(Gly-Gly); RefChem:83021; DTXCID5032997; 203-411-5; MFCD00006009; Piperazinedione; Glycine, N-glycyl-, cyclic peptide; NSC 26345; Cyclic(glycylglycyl); .alpha.,.gamma.-Diacipiperazine; NSC26345; Piperazine-2,5-dione (Glycine Anhydride); F0278-0016; 1,4-diazaperhydroine-2,5-dione; Glycine Anhydride(2,5-Piperazinedione); Glycine EP Impurity B; EINECS 203-411-5; BRN 0112112; UNII-240L69DTV7; Glycocoll Anhydride; cyclo-(Gly-Gly); Oxiracetam Impurity 6; Glycine, cyclic peptide; piperazine-2,5-quinone; SCHEMBL66638; 5-24-05-00294 (Beilstein Handbook Reference); SCHEMBL137800; CHEMBL125229; SCHEMBL1057700; SCHEMBL7365089; 2,5-PIPERAZINEDIONE [MI]; Glycine anhydride, cyclic dipeptide; SMSSF-0531123; SBB079702; STK741583; TETRAHYDRO-2,5-PYRAZINEDIONE; AKOS001056505; Glycine anhydride;2,5-Piperazinedione; FD05300; PS-4716; SY011208; ST4016141; CS-0046695; EU-0051025; G0100; NS00015771; CYCLO-GLYCYLGLYCINE (3,3,6,6-D4); EN300-16993; C02777; F11382; AC-907/30002028; F358180; BRD-K95941975-001-01-5; Q27101960; Z56854487; InChI=1/C4H6N2O2/c7-3-1-5-4(8)2-6-3/h1-2H2,(H,5,8)(H,6,7;
|
Specifications: |
|
|
Item |
Standards |
|
Appearance: |
White or off-white crystalline powder |
|
Odor: |
Characteristic |
|
Identification: |
IR/HPLC/Mass/NMR Spectrum |
|
Purity (HPLC): |
≥99.0% |
|
|
|
|
|
|
|
Applications: Glycine Anhydride, also known as 2,5-Diketopiperazine, is a cyclic dipeptide formed by the dehydration of two glycine molecules and is the smallest naturally occurring cyclopeptide. Its structure combines the stability of the peptide bond with the uniqueness of a cyclic structure. It appears as a white to light yellow crystalline powder, is chemically stable, and is easily soluble in hot water.
Main Uses: 1. Biochemical Reagent: Used directly as a biochemical reagent, its molecular symmetry makes it suitable for infrared studies. 2. Organic Synthesis Intermediate: Commonly used as a key intermediate in the synthesis of polypeptide compounds and heterocyclic compounds. 3. Glyphosate Raw Material: It is an important raw material for the piperazine route of the systemic, non-selective herbicide Glyphosate. 4. Biochemical Research: Used as a model compound to explore the mechanisms of peptide bond formation and cleavage. 5. Hydrolysis Product: Can be hydrolyzed by alkali, acid, or hot water to produce Glycylglycine. |
|
|
|
|
|
Package: 1/5/10/25kgs/drum |
|
|
UN number: Not dangerous goods |
|
|
Store at: Sealed storage in a cool and dry place, avoid light and heat. |
|
|
Shelf Life: Two years |
|
Address：No. 338, Jingang Avenue, ZhangJiaGang City, Jiangsu Province, China. P.C.:215600Email：sales@healthchems.com
Tel：+86-512-58277800Fax：+86-512-58999904
